EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO4 |
| Net Charge | 0 |
| Average Mass | 201.222 |
| Monoisotopic Mass | 201.10011 |
| SMILES | [NH3+][C@@H](C[C@@H]1CC[C@@H](O)[C@@H]2O[C@H]12)C(=O)[O-] |
| InChI | InChI=1S/C9H15NO4/c10-5(9(12)13)3-4-1-2-6(11)8-7(4)14-8/h4-8,11H,1-3,10H2,(H,12,13)/t4-,5-,6+,7+,8-/m0/s1 |
| InChIKey | YMLXTGCTHGQQKS-TXXZRHAASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dihydroanticapsin zwitterion (CHEBI:84358) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-dihydroanticapsin zwitterion (CHEBI:84358) is tautomer of L-dihydroanticapsin (CHEBI:85360) |
| Incoming Relation(s) |
| L-dihydroanticapsin (CHEBI:85360) is tautomer of L-dihydroanticapsin zwitterion (CHEBI:84358) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-[(1R,2S,5R,6S )-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate |
| Synonym | Source |
|---|---|
| (1R,2S,5R,6S)-dihydroanticapsin zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-dihydroanticapsin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17531 | MetaCyc |
| Citations |
|---|