EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12FNO3 |
| Net Charge | 0 |
| Average Mass | 261.252 |
| Monoisotopic Mass | 261.08012 |
| SMILES | C[C@@H]1CCc2cc(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C14H12FNO3/c1-7-2-3-8-4-9(15)5-10-12(8)16(7)6-11(13(10)17)14(18)19/h4-7H,2-3H2,1H3,(H,18,19)/t7-/m1/s1 |
| InChIKey | DPSPPJIUMHPXMA-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-flumequine (CHEBI:85273) is a 9-fluoro-5-methyl-1-oxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid (CHEBI:85269) |
| (R)-flumequine (CHEBI:85273) is enantiomer of (S)-flumequine (CHEBI:85272) |
| Incoming Relation(s) |
| flumequine (CHEBI:85267) has part (R)-flumequine (CHEBI:85273) |
| (S)-flumequine (CHEBI:85272) is enantiomer of (R)-flumequine (CHEBI:85273) |
| IUPAC Name |
|---|
| (5R)-9-fluoro-5-methyl-1-oxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8273773 | Reaxys |