EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/b7-4-,14-13+/t16-,17-,18+/m0/s1 |
| InChIKey | UQOQENZZLBSFKO-POPPZSFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin J2 (CHEBI:27485) has functional parent prostaglandin D2 (CHEBI:15555) |
| prostaglandin J2 (CHEBI:27485) has role human metabolite (CHEBI:77746) |
| prostaglandin J2 (CHEBI:27485) is a prostaglandins J (CHEBI:26346) |
| prostaglandin J2 (CHEBI:27485) is conjugate acid of prostaglandin J2(1−) (CHEBI:133396) |
| Incoming Relation(s) |
| (R)-PGJ2-S-glutathione conjugate (CHEBI:136110) has functional parent prostaglandin J2 (CHEBI:27485) |
| (S)-PGJ2-S-glutathione conjugate (CHEBI:136112) has functional parent prostaglandin J2 (CHEBI:27485) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) has functional parent prostaglandin J2 (CHEBI:27485) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) has functional parent prostaglandin J2 (CHEBI:27485) |
| prostaglandin J2(1−) (CHEBI:133396) is conjugate base of prostaglandin J2 (CHEBI:27485) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-15-hydroxy-11-oxoprosta-5,9,13-trien-1-oic acid |
| Synonyms | Source |
|---|---|
| 9-Deoxy-delta-9-pgd2 | ChemIDplus |
| 9-Deoxy-delta-9-prostaglandin D2 | ChemIDplus |
| PGJ2 | KEGG COMPOUND |
| Prostaglandin J2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05957 | KEGG COMPOUND |
| HMDB0002710 | HMDB |
| LMFA03010019 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8353080 | Reaxys |
| CAS:60203-57-8 | ChemIDplus |
| CAS:60203-57-8 | KEGG COMPOUND |
| Citations |
|---|