EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCCCC[C@H](O)C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h4,7,12,14-17,21H,2-3,5-6,8-11,13H2,1H3,(H,23,24)/b7-4-,18-14+/t16-,17-/m0/s1 |
| InChIKey | TUXFWOHFPFBNEJ-GJGHEGAFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) has functional parent prostaglandin J2 (CHEBI:27485) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) has role antineoplastic agent (CHEBI:35610) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) has role antiviral agent (CHEBI:22587) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) is a prostaglandins J (CHEBI:26346) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) is a secondary alcohol (CHEBI:35681) |
| 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) is conjugate acid of 13,14-dihydro-Δ12-prostaglandin J2(1−) (CHEBI:133424) |
| Incoming Relation(s) |
| 13,14-dihydro-Δ12-prostaglandin J2(1−) (CHEBI:133424) is conjugate base of 13,14-dihydro-Δ12-prostaglandin J2 (CHEBI:28130) |
| IUPAC Name |
|---|
| (5Z,12E,15S)-15-hydroxy-11-oxoprosta-5,9,12-trien-1-oic acid |
| Synonyms | Source |
|---|---|
| 9-Deoxy-9,10-didehydro-12,13-didehydro-13,14-dihydroprostaglandin D2 | ChemIDplus |
| 9-Deoxy-delta(9,12)-13,14-dihydro PGD2 | ChemIDplus |
| 9-Deoxy-delta(9), delta(12)-13,14-dihydroprostaglandin D2 | ChemIDplus |
| d12-PGJ2 | ChEBI |
| Dddd-PGD2 | ChemIDplus |
| delta-12-PGJ2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05958 | KEGG COMPOUND |
| LMFA03010020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:87893-54-7 | KEGG COMPOUND |
| CAS:87893-54-7 | ChemIDplus |