EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | CCCCC/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23/h6-7,9-10,13,15-17H,2-5,8,11-12,14H2,1H3,(H,22,23)/b9-7-,10-6+,18-13+/t17-/m0/s1 |
| InChIKey | VHRUMKCAEVRUBK-GODQJPCRSA-N |
| Roles Classification |
|---|
| Chemical Role: | electrophilic reagent A reagent that forms a bond to its reaction partner (the nucleophile) by accepting both bonding electrons from that reaction partner. |
| Biological Roles: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | electrophilic reagent A reagent that forms a bond to its reaction partner (the nucleophile) by accepting both bonding electrons from that reaction partner. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) has functional parent prostaglandin J2 (CHEBI:27485) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) has role electrophilic reagent (CHEBI:59739) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) has role insulin-sensitizing drug (CHEBI:50864) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) has role metabolite (CHEBI:25212) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) is a prostaglandins J (CHEBI:26346) |
| 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) is conjugate acid of 15-deoxy-Δ12,14-prostaglandin J2(1−) (CHEBI:85236) |
| Incoming Relation(s) |
| 15-deoxy-Δ12,14-prostaglandin J2-2-glyceryl ester (CHEBI:85238) has functional parent 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) |
| 15-deoxy-Δ12,14-prostaglandin J2(1−) (CHEBI:85236) is conjugate base of 15-deoxy-Δ12,14-prostaglandin J2 (CHEBI:34159) |
| IUPAC Name |
|---|
| (5Z,12E,14E)-11-oxoprosta-5,9,12,14-tetraen-1-oic acid |
| Synonyms | Source |
|---|---|
| 15-Deoxy-delta-12,14-PGJ2 | KEGG COMPOUND |
| 15-Deoxy-delta-12,14-prostaglandin J2 | KEGG COMPOUND |
| 15-Deoxy-PGJ2 | KEGG COMPOUND |
| delta-12,14-15-Deoxy-PGJ2 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C14717 | KEGG COMPOUND |
| LMFA03010021 | LIPID MAPS |
| HMDB0005079 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9220741 | Reaxys |
| Citations |
|---|