EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C1)[C@H](C)[C@@H](O)[C@H](O)C[C@@H]2C=O |
| InChI | InChI=1S/C15H24O3/c1-9(2)11-4-5-15(7-11)10(3)14(18)13(17)6-12(15)8-16/h8,10-14,17-18H,1,4-7H2,2-3H3/t10-,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | YIGYYGXJIDAEOF-OJVARPOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxylubimin (CHEBI:85160) has functional parent lubimin (CHEBI:27774) |
| 3-hydroxylubimin (CHEBI:85160) has role plant metabolite (CHEBI:76924) |
| 3-hydroxylubimin (CHEBI:85160) is a aldehyde (CHEBI:17478) |
| 3-hydroxylubimin (CHEBI:85160) is a diol (CHEBI:23824) |
| 3-hydroxylubimin (CHEBI:85160) is a vetispirane sesquiterpenoid (CHEBI:36755) |
| IUPAC Name |
|---|
| (2R,5S,6S,8R,9R,10S)-8,9-dihydroxy-10-methyl-2-(prop-1-en-2-yl)spiro[4.5]decane-6-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| CPD-4744 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2332996 | Reaxys |