EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C1)[C@H](C)C[C@H](O)C[C@@H]2C=O |
| InChI | InChI=1S/C15H24O2/c1-10(2)12-4-5-15(8-12)11(3)6-14(17)7-13(15)9-16/h9,11-14,17H,1,4-8H2,2-3H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | CEVNHRPKRNTGKO-ZSAUSMIDSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lubimin (CHEBI:27774) has role antifungal agent (CHEBI:35718) |
| lubimin (CHEBI:27774) has role phytoalexin (CHEBI:26115) |
| lubimin (CHEBI:27774) is a vetispirane sesquiterpenoid (CHEBI:36755) |
| Incoming Relation(s) |
| 3-hydroxylubimin (CHEBI:85160) has functional parent lubimin (CHEBI:27774) |
| IUPAC Name |
|---|
| (2R,5S,6S,8S,10R)-8-hydroxy-10-methyl-2-(prop-1-en-2-yl)spiro[4.5]decane-6-carbaldehyde |
| Synonyms | Source |
|---|---|
| (2R,5S,6S,8S,10R)-8-hydroxy-2-isopropenyl-10-methylspiro[4.5]decane-6-carbaldehyde | IUPAC |
| Lubimin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2454654 | Reaxys |
| CAS:35951-50-9 | KEGG COMPOUND |
| CAS:35951-50-9 | ChemIDplus |