EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O4 |
| Net Charge | 0 |
| Average Mass | 338.403 |
| Monoisotopic Mass | 338.15181 |
| SMILES | COc1c([C@@H]2COc3cc(O)ccc3C2)ccc2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C21H22O4/c1-21(2)9-8-17-18(25-21)7-6-16(20(17)23-3)14-10-13-4-5-15(22)11-19(13)24-12-14/h4-9,11,14,22H,10,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | CSEWDTXNCZLZIW-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | DOI (10.1007/s11816-015-0350-y) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-O-methylphaseollinisoflavan (CHEBI:85117) has functional parent (−)-phaseollinisoflavan (CHEBI:109) |
| 2'-O-methylphaseollinisoflavan (CHEBI:85117) has role plant metabolite (CHEBI:76924) |
| 2'-O-methylphaseollinisoflavan (CHEBI:85117) is a hydroxyisoflavans (CHEBI:76250) |
| 2'-O-methylphaseollinisoflavan (CHEBI:85117) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| (3R)-5'-methoxy-2',2'-dimethyl-3,4-dihydro-2H,2'H-[3,6'-bi-1-benzopyran]-7-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034412 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7941117 | Reaxys |