EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC1(C)C=Cc2c(ccc([C@@H]3COc4cc(O)ccc4C3)c2O)O1 |
| InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-17(24-20)6-5-15(19(16)22)13-9-12-3-4-14(21)10-18(12)23-11-13/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | UUJBHSNXZMGYBT-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-phaseollinisoflavan (CHEBI:109) has role plant metabolite (CHEBI:76924) |
| (−)-phaseollinisoflavan (CHEBI:109) is a hydroxyisoflavans (CHEBI:76250) |
| Incoming Relation(s) |
| 2'-O-methylphaseollinisoflavan (CHEBI:85117) has functional parent (−)-phaseollinisoflavan (CHEBI:109) |
| IUPAC Name |
|---|
| (3R)-2',2'-dimethyl-3,4-dihydro-2H,2'H-3,6'-bichromene-5',7-diol |