EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31N3O5 |
| Net Charge | 0 |
| Average Mass | 537.616 |
| Monoisotopic Mass | 537.22637 |
| SMILES | [H][C@@]12C[C@@](O)(C(=O)OCCCCCC)[C@@](C)(O1)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C32H31N3O5/c1-3-4-5-10-15-39-30(37)32(38)16-23-34-21-13-8-6-11-18(21)25-26-20(17-33-29(26)36)24-19-12-7-9-14-22(19)35(28(24)27(25)34)31(32,2)40-23/h6-9,11-14,23,38H,3-5,10,15-17H2,1-2H3,(H,33,36)/t23-,31+,32+/m0/s1 |
| InChIKey | ZHEHVZXPFVXKEY-RUAOOFDTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.11 (cAMP-dependent protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cAMP-dependent protein kinase (EC 2.7.11.11). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KT 5720 (CHEBI:85085) has functional parent K-252a (CHEBI:43616) |
| KT 5720 (CHEBI:85085) has role EC 2.7.11.11 (cAMP-dependent protein kinase) inhibitor (CHEBI:85094) |
| KT 5720 (CHEBI:85085) is a carboxylic ester (CHEBI:33308) |
| KT 5720 (CHEBI:85085) is a hemiaminal (CHEBI:73080) |
| KT 5720 (CHEBI:85085) is a indolocarbazole (CHEBI:51915) |
| KT 5720 (CHEBI:85085) is a organic heterooctacyclic compound (CHEBI:38165) |
| KT 5720 (CHEBI:85085) is a semisynthetic derivative (CHEBI:72588) |
| KT 5720 (CHEBI:85085) is a tertiary alcohol (CHEBI:26878) |
| KT 5720 (CHEBI:85085) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| hexyl (5R,6S,8S)-6-hydroxy-5-methyl-13-oxo-5,6,7,8,14,15-hexahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-6-carboxylate |
| Synonyms | Source |
|---|---|
| KT5720 | ChEBI |
| KT-5720 | ChemIDplus |
| (9R,10S,12S)-2,3,9,10,11,12-hexahydro-10-hydroxy-9-methyl-1-oxo-9,12-epoxy-1H-diindolo[1,2,3-fg:3',2',1'-kl]pyrrolo[3,4-i][1,6]benzodiazocine-10-carboxylic acid hexyl ester | ChEBI |
| antibiotic KT 5720 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8376260 | Reaxys |
| CAS:108068-98-0 | ChemIDplus |
| Citations |
|---|