EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21N3O5 |
| Net Charge | 0 |
| Average Mass | 467.481 |
| Monoisotopic Mass | 467.14812 |
| SMILES | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C27H21N3O5/c1-26-27(33,25(32)34-2)11-18(35-26)29-16-9-5-3-7-13(16)20-21-15(12-28-24(21)31)19-14-8-4-6-10-17(14)30(26)23(19)22(20)29/h3-10,18,33H,11-12H2,1-2H3,(H,28,31)/t18-,26+,27+/m1/s1 |
| InChIKey | KOZFSFOOLUUIGY-SOLYNIJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis sp. K-252a (ncbitaxon:310350) | - | PubMed (3759657) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). tropomyosin-related kinase B receptor antagonist An antagonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| K-252a (CHEBI:43616) has role antimicrobial agent (CHEBI:33281) |
| K-252a (CHEBI:43616) has role bacterial metabolite (CHEBI:76969) |
| K-252a (CHEBI:43616) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| K-252a (CHEBI:43616) has role tropomyosin-related kinase B receptor antagonist (CHEBI:78681) |
| K-252a (CHEBI:43616) is a bridged compound (CHEBI:35990) |
| K-252a (CHEBI:43616) is a methyl ester (CHEBI:25248) |
| K-252a (CHEBI:43616) is a organic heterooctacyclic compound (CHEBI:38165) |
| K-252a (CHEBI:43616) is a γ-lactam (CHEBI:74222) |
| Incoming Relation(s) |
| KT 5720 (CHEBI:85085) has functional parent K-252a (CHEBI:43616) |
| IUPAC Name |
|---|
| methyl (5S,6R,8R)-6-hydroxy-5-methyl-13-oxo-5,6,7,8,14,15-hexahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-6-carboxylate |
| Synonyms | Source |
|---|---|
| Antibiotic K 252a | ChemIDplus |
| Antibiotic SF 2370 | ChemIDplus |
| K252a | ChemIDplus |
| SF 2370 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| K-252a | UniProt |
| Manual Xrefs | Databases |
|---|---|
| KSA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7419675 | Reaxys |
| CAS:99533-80-9 | ChemIDplus |
| Citations |
|---|