EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29FN3O9P |
| Net Charge | 0 |
| Average Mass | 529.458 |
| Monoisotopic Mass | 529.16254 |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)nc2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29FN3O9P/c1-13(2)33-19(29)14(3)25-36(31,35-15-8-6-5-7-9-15)32-12-16-18(28)22(4,23)20(34-16)26-11-10-17(27)24-21(26)30/h5-11,13-14,16,18,20,28H,12H2,1-4H3,(H,25,31)(H,24,27,30)/t14-,16+,18+,20+,22+,36-/m0/s1 |
| InChIKey | TTZHDVOVKQGIBA-IQWMDFIBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sofosbuvir (CHEBI:85083) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| sofosbuvir (CHEBI:85083) has role antiviral drug (CHEBI:36044) |
| sofosbuvir (CHEBI:85083) has role hepatitis C protease inhibitor (CHEBI:64924) |
| sofosbuvir (CHEBI:85083) has role prodrug (CHEBI:50266) |
| sofosbuvir (CHEBI:85083) is a L-alanyl ester (CHEBI:61164) |
| sofosbuvir (CHEBI:85083) is a isopropyl ester (CHEBI:35725) |
| sofosbuvir (CHEBI:85083) is a nucleotide conjugate (CHEBI:47784) |
| sofosbuvir (CHEBI:85083) is a organofluorine compound (CHEBI:37143) |
| sofosbuvir (CHEBI:85083) is a phosphoramidate ester (CHEBI:27577) |
| Incoming Relation(s) |
| Epclusa (CHEBI:133008) has part sofosbuvir (CHEBI:85083) |
| Harvoni (CHEBI:85082) has part sofosbuvir (CHEBI:85083) |
| Synonyms | Source |
|---|---|
| GI 7977 | ChemIDplus |
| GS-7977 | ChemIDplus |
| isopropyl (2S)-2-{[(S)-{[(2R,3R,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-fluoro-3-hydroxy-4-methyltetrahydrofuran-2-yl]methoxy}(phenoxy)phosphoryl]amino}propanoate | IUPAC |
| PSI 7977 | ChemIDplus |
| PSI-7977 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sovaldi | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4811 | DrugCentral |
| D10366 | KEGG DRUG |
| Sofosbuvir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20867484 | Reaxys |
| CAS:1190307-88-0 | KEGG DRUG |
| CAS:1190307-88-0 | ChemIDplus |
| Citations |
|---|