EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13NO2 |
| Net Charge | 0 |
| Average Mass | 119.164 |
| Monoisotopic Mass | 119.09463 |
| SMILES | COC(OC)N(C)C |
| InChI | InChI=1S/C5H13NO2/c1-6(2)5(7-3)8-4/h5H,1-4H3 |
| InChIKey | ZSXGLVDWWRXATF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) has functional parent N,N-dimethylformamide (CHEBI:17741) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) has role chromatographic reagent (CHEBI:59745) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) is a acetal (CHEBI:59769) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1,1-dimethoxy-N,N-dimethylmethanamine |
| Synonyms | Source |
|---|---|
| 1,1-Dimethoxytrimethylamine | ChemIDplus |
| Dimethoxy(dimethylamino)methane | NIST Chemistry WebBook |
| dimethylformamide dimethyl acetal | ChEBI |
| Dimethylformamide-dimethylacetal | ChemIDplus |
| DMF Dimethyl acetal | NIST Chemistry WebBook |
| DMF-DMA | SUBMITTER |