EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO |
| Net Charge | 0 |
| Average Mass | 73.095 |
| Monoisotopic Mass | 73.05276 |
| SMILES | [H]C(=O)N(C)C |
| InChI | InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3 |
| InChIKey | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Biological Role: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylformamide (CHEBI:17741) has functional parent formamide (CHEBI:16397) |
| N,N-dimethylformamide (CHEBI:17741) has role geroprotector (CHEBI:176497) |
| N,N-dimethylformamide (CHEBI:17741) has role hepatotoxic agent (CHEBI:50908) |
| N,N-dimethylformamide (CHEBI:17741) has role polar aprotic solvent (CHEBI:48358) |
| N,N-dimethylformamide (CHEBI:17741) is a formamides (CHEBI:24079) |
| N,N-dimethylformamide (CHEBI:17741) is a volatile organic compound (CHEBI:134179) |
| Incoming Relation(s) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) has functional parent N,N-dimethylformamide (CHEBI:17741) |
| IUPAC Name |
|---|
| N,N-dimethylformamide |
| Synonyms | Source |
|---|---|
| Dimethylformamide | ChemIDplus |
| DMF | KEGG COMPOUND |
| N-Formyldimethylamine | NIST Chemistry WebBook |
| N,N-Dimethylformamide | KEGG COMPOUND |
| N,N-Dimethylmethanamide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| N,N-dimethylformamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03134 | KEGG COMPOUND |
| CPD-581 | MetaCyc |
| DB01844 | DrugBank |
| Dimethylformamide | Wikipedia |
| DMF | PDBeChem |
| HMDB0001888 | HMDB |
| Citations |
|---|