EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO |
| Net Charge | 0 |
| Average Mass | 73.095 |
| Monoisotopic Mass | 73.05276 |
| SMILES | [H]C(=O)N(C)C |
| InChI | InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3 |
| InChIKey | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Biological Role: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylformamide (CHEBI:17741) has functional parent formamide (CHEBI:16397) |
| N,N-dimethylformamide (CHEBI:17741) has role geroprotector (CHEBI:176497) |
| N,N-dimethylformamide (CHEBI:17741) has role hepatotoxic agent (CHEBI:50908) |
| N,N-dimethylformamide (CHEBI:17741) has role polar aprotic solvent (CHEBI:48358) |
| N,N-dimethylformamide (CHEBI:17741) is a formamides (CHEBI:24079) |
| N,N-dimethylformamide (CHEBI:17741) is a volatile organic compound (CHEBI:134179) |
| Incoming Relation(s) |
| N,N-dimethylformamide dimethyl acetal (CHEBI:85061) has functional parent N,N-dimethylformamide (CHEBI:17741) |
| IUPAC Name |
|---|
| N,N-dimethylformamide |
| Synonyms | Source |
|---|---|
| Dimethylformamide | ChemIDplus |
| DMF | KEGG COMPOUND |
| N-Formyldimethylamine | NIST Chemistry WebBook |
| N,N-Dimethylformamide | KEGG COMPOUND |
| N,N-Dimethylmethanamide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| N,N-dimethylformamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03134 | KEGG COMPOUND |
| CPD-581 | MetaCyc |
| DB01844 | DrugBank |
| Dimethylformamide | Wikipedia |
| DMF | PDBeChem |
| HMDB0001888 | HMDB |
| Citations |
|---|