EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CCCCCCC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-12-15-18(2)16-13-10-8-6-7-9-11-14-17-19(20)21/h18H,3-17H2,1-2H3,(H,20,21) |
| InChIKey | MEBDGIUGSQZVMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methyloctadecanoic acid (CHEBI:85058) has functional parent octadecanoic acid (CHEBI:28842) |
| 12-methyloctadecanoic acid (CHEBI:85058) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 12-methyloctadecanoic acid (CHEBI:85058) is a long-chain fatty acid (CHEBI:15904) |
| 12-methyloctadecanoic acid (CHEBI:85058) is a methyl-branched fatty acid (CHEBI:62499) |
| 12-methyloctadecanoic acid (CHEBI:85058) is conjugate acid of 12-methyloctadecanoate (CHEBI:84176) |
| Incoming Relation(s) |
| 12-methyloctadecanoyl-CoA (CHEBI:85073) has functional parent 12-methyloctadecanoic acid (CHEBI:85058) |
| 12-methyloctadecanoate (CHEBI:84176) is conjugate base of 12-methyloctadecanoic acid (CHEBI:85058) |
| IUPAC Name |
|---|
| 12-methyloctadecanoic acid |
| Synonyms | Source |
|---|---|
| 12-methyl-octadecanoic acid | LIPID MAPS |
| 12-methylstearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020211 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725996 | Reaxys |