EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37O2 |
| Net Charge | -1 |
| Average Mass | 297.503 |
| Monoisotopic Mass | 297.27990 |
| SMILES | CCCCCCC(C)CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-12-15-18(2)16-13-10-8-6-7-9-11-14-17-19(20)21/h18H,3-17H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | MEBDGIUGSQZVMA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methyloctadecanoate (CHEBI:84176) is a fatty acid anion 19:0 (CHEBI:78892) |
| 12-methyloctadecanoate (CHEBI:84176) is a long-chain fatty acid anion (CHEBI:57560) |
| 12-methyloctadecanoate (CHEBI:84176) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 12-methyloctadecanoate (CHEBI:84176) is conjugate base of 12-methyloctadecanoic acid (CHEBI:85058) |
| Incoming Relation(s) |
| 12-methyloctadecanoic acid (CHEBI:85058) is conjugate acid of 12-methyloctadecanoate (CHEBI:84176) |
| IUPAC Name |
|---|
| 12-methyloctadecanoate |
| Synonyms | Source |
|---|---|
| 12-methyloctadecanoate(1−) | ChEBI |
| 12-methylstearate | ChEBI |
| UniProt Name | Source |
|---|---|
| 12-methyloctadecanoate | UniProt |
| Citations |
|---|