EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCCCCC(C)C(=O)O |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | AXPAUZGVNGEWJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhexadecanoic acid (CHEBI:85057) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2-methylhexadecanoic acid (CHEBI:85057) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 2-methylhexadecanoic acid (CHEBI:85057) is a long-chain fatty acid (CHEBI:15904) |
| 2-methylhexadecanoic acid (CHEBI:85057) is a methyl-branched fatty acid (CHEBI:62499) |
| 2-methylhexadecanoic acid (CHEBI:85057) is conjugate acid of 2-methylhexadecanoate (CHEBI:84175) |
| Incoming Relation(s) |
| 2-methylhexadecanoyl-CoA (CHEBI:85074) has functional parent 2-methylhexadecanoic acid (CHEBI:85057) |
| 2-methylhexadecanoate (CHEBI:84175) is conjugate base of 2-methylhexadecanoic acid (CHEBI:85057) |
| IUPAC Name |
|---|
| 2-methylhexadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-hexadecanoic acid | LIPID MAPS |
| 2-Methylpalmitic acid | ChemIDplus |
| α-methylhexadecanoic acid | ChEBI |
| α-methylpalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020092 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1782974 | Reaxys |
| CAS:27147-71-3 | ChemIDplus |