EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H33O2 |
| Net Charge | -1 |
| Average Mass | 269.449 |
| Monoisotopic Mass | 269.24860 |
| SMILES | CCCCCCCCCCCCCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17(18)19/h16H,3-15H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | AXPAUZGVNGEWJD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhexadecanoate (CHEBI:84175) is a 2-methyl fatty acid anion (CHEBI:83976) |
| 2-methylhexadecanoate (CHEBI:84175) is a fatty acid anion 17:0 (CHEBI:78124) |
| 2-methylhexadecanoate (CHEBI:84175) is a long-chain fatty acid anion (CHEBI:57560) |
| 2-methylhexadecanoate (CHEBI:84175) is conjugate base of 2-methylhexadecanoic acid (CHEBI:85057) |
| Incoming Relation(s) |
| 2-methylhexadecanoic acid (CHEBI:85057) is conjugate acid of 2-methylhexadecanoate (CHEBI:84175) |
| IUPAC Name |
|---|
| 2-methylhexadecanoate |
| Synonym | Source |
|---|---|
| 2-methylhexadecanoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylhexadecanoate | UniProt |
| Citations |
|---|