EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C16H21NO2.Cl |
| Net Charge | 0 |
| Average Mass | 295.810 |
| Monoisotopic Mass | 295.13391 |
| SMILES | CC(C)NCC(O)COc1cccc2ccccc12.[Cl-].[H+] |
| InChI | InChI=1S/C16H21NO2.ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;/h3-9,12,14,17-18H,10-11H2,1-2H3;1H |
| InChIKey | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propranolol hydrochloride (CHEBI:8500) has part propranolol (CHEBI:8499) |
| propranolol hydrochloride (CHEBI:8500) has role anti-arrhythmia drug (CHEBI:38070) |
| propranolol hydrochloride (CHEBI:8500) has role antihypertensive agent (CHEBI:35674) |
| propranolol hydrochloride (CHEBI:8500) has role antineoplastic agent (CHEBI:35610) |
| propranolol hydrochloride (CHEBI:8500) has role cardiovascular drug (CHEBI:35554) |
| propranolol hydrochloride (CHEBI:8500) has role hypoglycemic agent (CHEBI:35526) |
| propranolol hydrochloride (CHEBI:8500) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(naphthalen-1-yloxy)-1-(propan-2-ylamino)propan-2-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(1-Naphthyloxy)-2-hydroxy-3-isopropylaminopropane hydrochloride | ChemIDplus |
| 1-Isopropylamino-3-(1-naphthoxy)-propan-2-ol-hydrochloride | ChemIDplus |
| 1-(Isopropylamino)-3-(1-naphthoxy)-propan-2-ol hydrochloride | ChemIDplus |
| (+-)-1-(Isopropylamino)-3-(1-naphthyloxy)-2-propanol hydrochloride | ChemIDplus |
| 1-(Isopropylamino)-3-(1-naphthyloxy)-2-propanol hydrochloride | ChemIDplus |
| AY 64043 | ChEMBL |
| Brand Names | Source |
|---|---|
| Anaprilin | ChEMBL |
| Angilol | ChEMBL |
| Apsolol | ChEMBL |
| Avlocardyl | ChEMBL |
| Bedranol | ChEMBL |
| Bedranol s.r. | ChEMBL |
| Citations |
|---|