EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | -2 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04336 |
| SMILES | CC(CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H10O4/c1-4(6(9)10)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10)/p-2 |
| InChIKey | AQYCMVICBNBXNA-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa domesticus (ncbitaxon:9825) | |||
| - | DOI (10.1007/s11306-012-0441-5) | ||
| - | MetaboLights (MTBLS123) |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylglutarate(2−) (CHEBI:84980) has role mammalian metabolite (CHEBI:75768) |
| 2-methylglutarate(2−) (CHEBI:84980) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-methylglutarate(2−) (CHEBI:84980) is conjugate base of 2-methylglutaric acid (CHEBI:68567) |
| Incoming Relation(s) |
| 2-methylglutaric acid (CHEBI:68567) is conjugate acid of 2-methylglutarate(2−) (CHEBI:84980) |
| IUPAC Name |
|---|
| 2-methylpentanedioate |