EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-4(6(9)10)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | AQYCMVICBNBXNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa domesticus (ncbitaxon:9825) | |||
| - | MetaboLights (MTBLS123) | ||
| - | DOI (10.1007/s11306-012-0441-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylglutaric acid (CHEBI:68567) has functional parent glutaric acid (CHEBI:17859) |
| 2-methylglutaric acid (CHEBI:68567) has role mammalian metabolite (CHEBI:75768) |
| 2-methylglutaric acid (CHEBI:68567) is a dicarboxylic fatty acid (CHEBI:189840) |
| 2-methylglutaric acid (CHEBI:68567) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 2-methylglutaric acid (CHEBI:68567) is conjugate acid of 2-methylglutarate(2−) (CHEBI:84980) |
| Incoming Relation(s) |
| 2-methylglutarate(2−) (CHEBI:84980) is conjugate base of 2-methylglutaric acid (CHEBI:68567) |
| IUPAC Name |
|---|
| 2-methylpentanedioic acid |
| Synonym | Source |
|---|---|
| α-methylglutaric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000422 | HMDB |
| LMFA01170084 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723219 | Reaxys |
| CAS:18069-17-5 | ChemIDplus |
| Citations |
|---|