EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84978 - 2-ethylacrylic acid
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C=C(CC)C(=O)O |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | WROUWQQRXUBECT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa domesticus (ncbitaxon:9825) | |||
| - | MetaboLights (MTBLS123) | ||
| - | DOI (10.1007/s11306-012-0441-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylacrylic acid (CHEBI:84978) has functional parent acrylic acid (CHEBI:18308) |
| 2-ethylacrylic acid (CHEBI:84978) has role mammalian metabolite (CHEBI:75768) |
| 2-ethylacrylic acid (CHEBI:84978) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-ethylacrylic acid (CHEBI:84978) is conjugate acid of 2-ethylacrylate (CHEBI:84979) |
| Incoming Relation(s) |
| 2-ethylacrylate (CHEBI:84979) is conjugate base of 2-ethylacrylic acid (CHEBI:84978) |
| IUPAC Name |
|---|
| 2-methylidenebutanoic acid |
| Synonyms | Source |
|---|---|
| 2-ethyl-2-propenoic acid | LIPID MAPS |
| α-methylene-butanoic acid | ChEBI |
| 2-Ethylpropenoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001862 | HMDB |
| LMFA01020111 | LIPID MAPS |
| Citations |
|---|