EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H56O2 |
| Net Charge | 0 |
| Average Mass | 424.754 |
| Monoisotopic Mass | 424.42803 |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H56O2/c1-27(2)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-28(29)30/h27H,3-26H2,1-2H3,(H,29,30) |
| InChIKey | GCUBDUZUXAQLEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-methylheptacosanoic acid (CHEBI:84907) has functional parent heptacosanoic acid (CHEBI:78710) |
| 26-methylheptacosanoic acid (CHEBI:84907) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 26-methylheptacosanoic acid (CHEBI:84907) is a methyl-branched fatty acid (CHEBI:62499) |
| 26-methylheptacosanoic acid (CHEBI:84907) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| 26-methylheptacosanoic acid |
| Synonym | Source |
|---|---|
| Isomontanic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020026 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1801614 | Reaxys |