EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H54O2 |
| Net Charge | 0 |
| Average Mass | 410.727 |
| Monoisotopic Mass | 410.41238 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C27H54O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29/h2-26H2,1H3,(H,28,29) |
| InChIKey | VXZBFBRLRNDJCS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptacosanoic acid (CHEBI:78710) has role plant metabolite (CHEBI:76924) |
| heptacosanoic acid (CHEBI:78710) is a straight-chain saturated fatty acid (CHEBI:39418) |
| heptacosanoic acid (CHEBI:78710) is a very long-chain fatty acid (CHEBI:27283) |
| heptacosanoic acid (CHEBI:78710) is conjugate acid of heptacosanoate (CHEBI:78020) |
| Incoming Relation(s) |
| 26-methylheptacosanoic acid (CHEBI:84907) has functional parent heptacosanoic acid (CHEBI:78710) |
| ω-hydroxyheptacosanoic acid (CHEBI:84861) has functional parent heptacosanoic acid (CHEBI:78710) |
| heptacosanoate (CHEBI:78020) is conjugate base of heptacosanoic acid (CHEBI:78710) |
| IUPAC Name |
|---|
| heptacosanoic acid |
| Synonyms | Source |
|---|---|
| C27:0 | LIPID MAPS |
| Carboceric acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-7829 | MetaCyc |
| HMDB0002063 | HMDB |
| LMFA01010027 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1800778 | Reaxys |
| CAS:7138-40-1 | ChemIDplus |
| Citations |
|---|