EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CC(C)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | ZONJATNKKGGVSU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cervus nippon (ncbitaxon:9863) | - | PubMed (15112737) | Found in the preorbital gland secretion. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-methylpentadecanoic acid (CHEBI:84890) has functional parent pentadecanoic acid (CHEBI:42504) |
| 14-methylpentadecanoic acid (CHEBI:84890) has role biomarker (CHEBI:59163) |
| 14-methylpentadecanoic acid (CHEBI:84890) has role mammalian metabolite (CHEBI:75768) |
| 14-methylpentadecanoic acid (CHEBI:84890) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 14-methylpentadecanoic acid (CHEBI:84890) is a fatty acid 16:0 (CHEBI:140943) |
| 14-methylpentadecanoic acid (CHEBI:84890) is a long-chain fatty acid (CHEBI:15904) |
| 14-methylpentadecanoic acid (CHEBI:84890) is a methyl-branched fatty acid (CHEBI:62499) |
| 14-methylpentadecanoic acid (CHEBI:84890) is conjugate acid of 14-methylpentadecanoate (CHEBI:183088) |
| Incoming Relation(s) |
| 14-methylpentadecanoate (CHEBI:183088) is conjugate base of 14-methylpentadecanoic acid (CHEBI:84890) |
| IUPAC Name |
|---|
| 14-methylpentadecanoic acid |
| Synonyms | Source |
|---|---|
| 14-methyl pentadecylic acid | LIPID MAPS |
| Iso-C16:0 | HMDB |
| isohexadecanoic acid | LIPID MAPS |
| isopalmitic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031068 | HMDB |
| LMFA01020010 | LIPID MAPS |
| Citations |
|---|