EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O2 |
| Net Charge | -1 |
| Average Mass | 255.422 |
| Monoisotopic Mass | 255.23295 |
| SMILES | CC(C)CCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C16H32O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | ZONJATNKKGGVSU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-methylpentadecanoate (CHEBI:183088) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| 14-methylpentadecanoate (CHEBI:183088) is a fatty acid anion 16:0 (CHEBI:78123) |
| 14-methylpentadecanoate (CHEBI:183088) is a long-chain fatty acid anion (CHEBI:57560) |
| 14-methylpentadecanoate (CHEBI:183088) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 14-methylpentadecanoate (CHEBI:183088) is conjugate base of 14-methylpentadecanoic acid (CHEBI:84890) |
| Incoming Relation(s) |
| 14-methylpentadecanoic acid (CHEBI:84890) is conjugate acid of 14-methylpentadecanoate (CHEBI:183088) |
| IUPAC Name |
|---|
| 14-methylpentadecanoate |
| Synonyms | Source |
|---|---|
| isopalmitate | SUBMITTER |
| 14-methylpentadecanoic acid(1−) | ChEBI |
| isopalmitic acid(1−) | ChEBI |
| isohexadecanoate | ChEBI |
| 14-methyl pentadecylic acid(1−) | ChEBI |
| 14-methyl pentadecylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 14-methylpentadecanoate | UniProt |
| Citations |
|---|