EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45N6O9 |
| Net Charge | -3 |
| Average Mass | 597.690 |
| Monoisotopic Mass | 597.32645 |
| SMILES | O=C1CCC(=O)N([O-])CCCCCNC(=O)CCC(=O)N([O-])CCCCCNC(=O)CCC(=O)N([O-])CCCCCN1 |
| InChI | InChI=1S/C27H45N6O9/c34-22-10-14-26(38)32(41)20-8-3-6-18-30-24(36)12-15-27(39)33(42)21-9-2-5-17-29-23(35)11-13-25(37)31(40)19-7-1-4-16-28-22/h1-21H2,(H,28,34)(H,29,35)(H,30,36)/q-3 |
| InChIKey | WXIWKPBDYNJGJA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrioxamine E(3−) (CHEBI:84730) has role siderophore (CHEBI:26672) |
| desferrioxamine E(3−) (CHEBI:84730) is a hydroxamic acid anion (CHEBI:24648) |
| desferrioxamine E(3−) (CHEBI:84730) is conjugate base of desferrioxamine E (CHEBI:50437) |
| Incoming Relation(s) |
| ferrioxamine E (CHEBI:60261) has part desferrioxamine E(3−) (CHEBI:84730) |
| desferrioxamine E (CHEBI:50437) is conjugate acid of desferrioxamine E(3−) (CHEBI:84730) |
| IUPAC Name |
|---|
| 2,5,13,16,24,27-hexaoxo-1,6,12,17,23,28-hexaazacyclotritriacontane-1,12,23-triolate |