EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N6O9 |
| Net Charge | 0 |
| Average Mass | 600.714 |
| Monoisotopic Mass | 600.34828 |
| SMILES | O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1 |
| InChI | InChI=1S/C27H48N6O9/c34-22-10-14-26(38)32(41)20-8-3-6-18-30-24(36)12-15-27(39)33(42)21-9-2-5-17-29-23(35)11-13-25(37)31(40)19-7-1-4-16-28-22/h40-42H,1-21H2,(H,28,34)(H,29,35)(H,30,36) |
| InChIKey | NHKCCADZVLTPPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citricoccus sp. (ncbitaxon:907777) | - | PubMed (21376551) | Strain: KMM 3890 |
| Erwinia amylovora (ncbitaxon:552) | - | PubMed (21814817) | |
| Streptomyces olivaceus (ncbitaxon:47716) | - | PubMed (1367428) | Strain: TU 2718 |
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21879726) | Previous component: resin; MeOH extract of cell mass and HP20 resin Strain: C34 |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrioxamine E (CHEBI:50437) has role antineoplastic agent (CHEBI:35610) |
| desferrioxamine E (CHEBI:50437) has role bacterial metabolite (CHEBI:76969) |
| desferrioxamine E (CHEBI:50437) has role marine metabolite (CHEBI:76507) |
| desferrioxamine E (CHEBI:50437) has role siderophore (CHEBI:26672) |
| desferrioxamine E (CHEBI:50437) is a cyclic desferrioxamine (CHEBI:50455) |
| desferrioxamine E (CHEBI:50437) is a cyclic hydroxamic acid (CHEBI:23445) |
| desferrioxamine E (CHEBI:50437) is a macrocycle (CHEBI:51026) |
| desferrioxamine E (CHEBI:50437) is conjugate acid of desferrioxamine E(3−) (CHEBI:84730) |
| Incoming Relation(s) |
| desferrioxamine E(3−) (CHEBI:84730) is conjugate base of desferrioxamine E (CHEBI:50437) |
| IUPAC Name |
|---|
| 1,12,23-trihydroxy-1,6,12,17,23,28-hexaazacyclotritriacontane-2,5,13,16,24,27-hexone |
| Synonyms | Source |
|---|---|
| deferrioxamine E | ChemIDplus |
| nocardamin | ChemIDplus |
| nocardamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-11957 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381704 | Reaxys |
| CAS:26605-16-3 | ChemIDplus |
| Citations |
|---|