EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36N7O11 |
| Net Charge | -3 |
| Average Mass | 562.557 |
| Monoisotopic Mass | 562.24893 |
| SMILES | C[C@@H](O)[C@@H](NC(=O)[C@H](N)CCCN([O-])C=O)C(=O)N([O-])CCC[C@H](NC(=O)[C@H](N)CCCN([O-])C=O)C(=O)O |
| InChI | InChI=1S/C21H36N7O11/c1-13(31)17(25-19(33)15(23)6-3-9-27(38)12-30)20(34)28(39)10-4-7-16(21(35)36)24-18(32)14(22)5-2-8-26(37)11-29/h11-17,31H,2-10,22-23H2,1H3,(H,24,32)(H,25,33)(H,35,36)/q-3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | FARPHEKKOHSSQW-OVYGPGRDSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coelichelin(3−) (CHEBI:84724) has role bacterial metabolite (CHEBI:76969) |
| coelichelin(3−) (CHEBI:84724) has role siderophore (CHEBI:26672) |
| coelichelin(3−) (CHEBI:84724) is a hydroxamic acid anion (CHEBI:24648) |
| coelichelin(3−) (CHEBI:84724) is conjugate base of coelichelin (CHEBI:80049) |
| Incoming Relation(s) |
| iron(III)-coelichelin (CHEBI:84718) has part coelichelin(3−) (CHEBI:84724) |
| coelichelin (CHEBI:80049) is conjugate acid of coelichelin(3−) (CHEBI:84724) |
| IUPAC Name |
|---|
| N2-(N5-formyl-N5-oxido-D-ornithyl)-N5-(N5-formyl-N5-oxido-D-ornithyl-D-allothreonyl)-N5-oxido-L-ornithine |