EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39N7O11 |
| Net Charge | 0 |
| Average Mass | 565.581 |
| Monoisotopic Mass | 565.27076 |
| SMILES | C[C@@H](O)[C@@H](NC(=O)[C@H](N)CCCN(O)C=O)C(=O)N(O)CCC[C@H](NC(=O)[C@H](N)CCCN(O)C=O)C(=O)O |
| InChI | InChI=1S/C21H39N7O11/c1-13(31)17(25-19(33)15(23)6-3-9-27(38)12-30)20(34)28(39)10-4-7-16(21(35)36)24-18(32)14(22)5-2-8-26(37)11-29/h11-17,31,37-39H,2-10,22-23H2,1H3,(H,24,32)(H,25,33)(H,35,36)/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | ZPJLQAOTGYKOBJ-OVYGPGRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coelicolor A3(2) (ncbitaxon:100226) | - | PubMed (21342472) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coelichelin (CHEBI:80049) has role bacterial metabolite (CHEBI:76969) |
| coelichelin (CHEBI:80049) has role siderophore (CHEBI:26672) |
| coelichelin (CHEBI:80049) is a formamides (CHEBI:24079) |
| coelichelin (CHEBI:80049) is a hydroxamic acid (CHEBI:24650) |
| coelichelin (CHEBI:80049) is a tetrapeptide (CHEBI:48030) |
| coelichelin (CHEBI:80049) is conjugate acid of coelichelin(3−) (CHEBI:84724) |
| Incoming Relation(s) |
| coelichelin(3−) (CHEBI:84724) is conjugate base of coelichelin (CHEBI:80049) |
| IUPAC Name |
|---|
| N2-(N5-formyl-N5-hydroxy-D-ornithyl)-N5-(N5-formyl-N5-hydroxy-D-ornithyl-D-allothreonyl)-N5-hydroxy-L-ornithine |
| Manual Xrefs | Databases |
|---|---|
| C15719 | KEGG COMPOUND |
| Citations |
|---|