EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O14 |
| Net Charge | -5 |
| Average Mass | 475.339 |
| Monoisotopic Mass | 475.08637 |
| SMILES | O=C([O-])C[C@@](O)(CC(=O)NCCC[C@@H](NC(=O)C[C@@](O)(CC(=O)[O-])C(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C17H24N2O14/c20-9(4-16(32,14(28)29)6-11(22)23)18-3-1-2-8(13(26)27)19-10(21)5-17(33,15(30)31)7-12(24)25/h8,32-33H,1-7H2,(H,18,20)(H,19,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31)/p-5/t8-,16+,17-/m1/s1 |
| InChIKey | VJSIXUQLTJCRCS-DFQXCPINSA-I |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphyloferrin A(5−) (CHEBI:142973) is a organic molecular entity (CHEBI:50860) |
| staphyloferrin A(5−) (CHEBI:142973) is conjugate base of staphyloferrin A (CHEBI:84711) |
| Incoming Relation(s) |
| staphyloferrin A (CHEBI:84711) is conjugate acid of staphyloferrin A(5−) (CHEBI:142973) |
| UniProt Name | Source |
|---|---|
| staphyloferrin A | UniProt |
| Citations |
|---|