EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O2 |
| Net Charge | 0 |
| Average Mass | 76.095 |
| Monoisotopic Mass | 76.05243 |
| SMILES | CC(O)CO |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
| InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propane-1,2-diol (CHEBI:16997) has role allergen (CHEBI:50904) |
| propane-1,2-diol (CHEBI:16997) has role human xenobiotic metabolite (CHEBI:76967) |
| propane-1,2-diol (CHEBI:16997) has role mouse metabolite (CHEBI:75771) |
| propane-1,2-diol (CHEBI:16997) has role protic solvent (CHEBI:48356) |
| propane-1,2-diol (CHEBI:16997) is a glycol (CHEBI:13643) |
| propane-1,2-diol (CHEBI:16997) is a propane-1,2-diols (CHEBI:26284) |
| Incoming Relation(s) |
| 2-hydroxypropyl dihydrogen phosphate (CHEBI:18025) has functional parent propane-1,2-diol (CHEBI:16997) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has functional parent propane-1,2-diol (CHEBI:16997) |
| (R)-propane-1,2-diol (CHEBI:28972) is a propane-1,2-diol (CHEBI:16997) |
| (S)-propane-1,2-diol (CHEBI:29002) is a propane-1,2-diol (CHEBI:16997) |
| IUPAC Name |
|---|
| propane-1,2-diol |
| Synonyms | Source |
|---|---|
| Propane-1,2-diol | KEGG COMPOUND |
| 1,2-Propanediol | KEGG COMPOUND |
| Propylene glycol | KEGG COMPOUND |
| 1,2-Propylenglykol | ChemIDplus |
| α-propyleneglycol | ChemIDplus |
| 1,2-dihydroxypropane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| propane-1,2-diol | UniProt |
| Citations |
|---|