EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N5O2S |
| Net Charge | 0 |
| Average Mass | 291.336 |
| Monoisotopic Mass | 291.07900 |
| SMILES | Nc1ccc(/N=N/c2ccc(S(N)(=O)=O)cc2)c(N)c1 |
| InChI | InChI=1S/C12H13N5O2S/c13-8-1-6-12(11(14)7-8)17-16-9-2-4-10(5-3-9)20(15,18)19/h1-7H,13-14H2,(H2,15,18,19)/b17-16+ |
| InChIKey | ABBQGOCHXSPKHJ-WUKNDPDISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prontosil (CHEBI:8464) has functional parent sulfanilamide (CHEBI:45373) |
| prontosil (CHEBI:8464) has role antibacterial drug (CHEBI:36047) |
| prontosil (CHEBI:8464) has role antimicrobial agent (CHEBI:33281) |
| prontosil (CHEBI:8464) is a azobenzenes (CHEBI:22682) |
| prontosil (CHEBI:8464) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-[(2,4-diaminophenyl)diazenyl]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| p-((2,4-Diaminophenyl)azo)benzenesulphonamide | ChemIDplus |
| Prontosil | KEGG COMPOUND |
| Prontosil rubrum | KEGG COMPOUND |
| Rubiazol | ChemIDplus |
| Sulfamidochrysoidine | KEGG COMPOUND |
| Citations |
|---|