EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O12 |
| Net Charge | -3 |
| Average Mass | 431.330 |
| Monoisotopic Mass | 431.09544 |
| SMILES | C[C@@H](C(=O)NCCOC(=O)C[C@](O)(CC(=O)[O-])C(=O)[O-])N1C(=O)CCC1(O)C(=O)[O-] |
| InChI | InChI=1S/C16H22N2O12/c1-8(18-9(19)2-3-16(18,29)14(26)27)12(23)17-4-5-30-11(22)7-15(28,13(24)25)6-10(20)21/h8,28-29H,2-7H2,1H3,(H,17,23)(H,20,21)(H,24,25)(H,26,27)/p-3/t8-,15+,16?/m0/s1 |
| InChIKey | IGQXNKDXMPSELX-BIAKFKOBSA-K |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vibrioferrin(3−) (CHEBI:84630) has role marine metabolite (CHEBI:76507) |
| vibrioferrin(3−) (CHEBI:84630) has role siderophore (CHEBI:26672) |
| vibrioferrin(3−) (CHEBI:84630) is a tricarboxylic acid trianion (CHEBI:27092) |
| vibrioferrin(3−) (CHEBI:84630) is conjugate base of vibrioferrin (CHEBI:84585) |
| Incoming Relation(s) |
| iron(III) vibrioferrin (CHEBI:84633) has part vibrioferrin(3−) (CHEBI:84630) |
| vibrioferrin (CHEBI:84585) is conjugate acid of vibrioferrin(3−) (CHEBI:84630) |
| IUPAC Name |
|---|
| (2R)-2-[2-(2-{[(2S)-2-(2-carboxylato-2-hydroxy-5-oxopyrrolidin-1-yl)propanoyl]amino}ethoxy)-2-oxoethyl]-2-hydroxysuccinate |