EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16ClN5 |
| Net Charge | 0 |
| Average Mass | 253.737 |
| Monoisotopic Mass | 253.10942 |
| SMILES | CC(C)NC(=N)NC(=N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H16ClN5/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H5,13,14,15,16,17) |
| InChIKey | SSOLNOMRVKKSON-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| proguanil (CHEBI:8455) has role antimalarial (CHEBI:38068) |
| proguanil (CHEBI:8455) has role antiprotozoal drug (CHEBI:35820) |
| proguanil (CHEBI:8455) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| proguanil (CHEBI:8455) is a biguanides (CHEBI:53662) |
| proguanil (CHEBI:8455) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide |
| INNs | Source |
|---|---|
| proguanil | ChemIDplus |
| proguanilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(p-chlorophenyl)-5-isopropylbiguanide | ChEBI |
| Chlorguanide | ChemIDplus |
| Chloroguanide | KEGG COMPOUND |
| N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide | KEGG COMPOUND |
| N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide | KEGG COMPOUND |
| Citations |
|---|