EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3 |
| Net Charge | 0 |
| Average Mass | 209.252 |
| Monoisotopic Mass | 209.09530 |
| SMILES | Nc1ccc2cc3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C13H11N3/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H,14-15H2 |
| InChIKey | WDVSHHCDHLJJJR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. |
| Biological Roles: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-diaminoacridine (CHEBI:8452) has role antibacterial agent (CHEBI:33282) |
| 3,6-diaminoacridine (CHEBI:8452) has role antineoplastic agent (CHEBI:35610) |
| 3,6-diaminoacridine (CHEBI:8452) has role antiseptic drug (CHEBI:48218) |
| 3,6-diaminoacridine (CHEBI:8452) has role carcinogenic agent (CHEBI:50903) |
| 3,6-diaminoacridine (CHEBI:8452) has role chromophore (CHEBI:23240) |
| 3,6-diaminoacridine (CHEBI:8452) has role intercalator (CHEBI:24853) |
| 3,6-diaminoacridine (CHEBI:8452) is a aminoacridines (CHEBI:51803) |
| 3,6-diaminoacridine (CHEBI:8452) is conjugate base of 3,6-diaminoacridine(1+) (CHEBI:74711) |
| Incoming Relation(s) |
| 3,6-diaminoacridine(1+) (CHEBI:74711) is conjugate acid of 3,6-diaminoacridine (CHEBI:8452) |
| IUPAC Name |
|---|
| acridine-3,6-diamine |
| INNs | Source |
|---|---|
| proflavina | ChemIDplus |
| proflavine | WHO MedNet |
| proflavine | ChEBI |
| proflavinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,8-Diaminoacridine | ChemIDplus |
| 3,6-acridinediamine | ChEBI |
| Proflavin | ChemIDplus |
| proflavine | ChEMBL |
| Citations |
|---|