EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C13H21N3O.Cl |
| Net Charge | 0 |
| Average Mass | 271.792 |
| Monoisotopic Mass | 271.14514 |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C13H21N3O.ClH/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H |
| InChIKey | ABTXGJFUQRCPNH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procainamide hydrochloride (CHEBI:8429) has part procainamide (CHEBI:8428) |
| procainamide hydrochloride (CHEBI:8429) has role anti-arrhythmia drug (CHEBI:38070) |
| procainamide hydrochloride (CHEBI:8429) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-amino-N-[2-(diethylamino)ethyl]benzamide hydrochloride |
| Synonym | Source |
|---|---|
| PA | ChEBI |
| Brand Names | Source |
|---|---|
| Procan | DrugBank |
| Procamide | DrugBank |
| Procanbid | DrugBank |
| Procapan | DrugBank |
| Pronestyl | DrugBank |
| Citations |
|---|