EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N3O |
| Net Charge | 0 |
| Average Mass | 235.331 |
| Monoisotopic Mass | 235.16846 |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) |
| InChIKey | REQCZEXYDRLIBE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procainamide (CHEBI:8428) has role anti-arrhythmia drug (CHEBI:38070) |
| procainamide (CHEBI:8428) has role platelet aggregation inhibitor (CHEBI:50427) |
| procainamide (CHEBI:8428) has role sodium channel blocker (CHEBI:38633) |
| procainamide (CHEBI:8428) is a benzamides (CHEBI:22702) |
| Incoming Relation(s) |
| procainamide hydrochloride (CHEBI:8429) has part procainamide (CHEBI:8428) |
| IUPAC Name |
|---|
| 4-amino-N-[2-(diethylamino)ethyl]benzamide |
| INNs | Source |
|---|---|
| procainamida | ChemIDplus |
| procainamide | ChemIDplus |
| procaïnamide | ChEBI |
| procainamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| p-Aminobenzoic diethylaminoethylamide | ChemIDplus |
| p-Amino-N-(2-diethylaminoethyl)benzamide | ChemIDplus |
| Procainamide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Biocoryl | DrugBank |
| Citations |
|---|