EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N |
| Net Charge | 0 |
| Average Mass | 87.166 |
| Monoisotopic Mass | 87.10480 |
| SMILES | CCC(C)NC |
| InChI | InChI=1S/C5H13N/c1-4-5(2)6-3/h5-6H,4H2,1-3H3 |
| InChIKey | PYFSCIWXNSXGNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylbutan-2-amine (CHEBI:84267) has functional parent sec-butylamine (CHEBI:74526) |
| N-methylbutan-2-amine (CHEBI:84267) has role human metabolite (CHEBI:77746) |
| N-methylbutan-2-amine (CHEBI:84267) is a secondary aliphatic amine (CHEBI:50981) |
| IUPAC Name |
|---|
| N-methylbutan-2-amine |
| Synonyms | Source |
|---|---|
| N-methyl-2-butanamine | ChEBI |
| N,1-dimethylpropylamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1361350 | Reaxys |
| CAS:7713-69-1 | ChemIDplus |
| Citations |
|---|