EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11N |
| Net Charge | 0 |
| Average Mass | 73.139 |
| Monoisotopic Mass | 73.08915 |
| SMILES | CCC(C)N |
| InChI | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
| InChIKey | BHRZNVHARXXAHW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sec-butylamine (CHEBI:74526) has role antifungal agrochemical (CHEBI:86328) |
| sec-butylamine (CHEBI:74526) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| sec-butylamine (CHEBI:74526) is a primary aliphatic amine (CHEBI:17062) |
| Incoming Relation(s) |
| N-methylbutan-2-amine (CHEBI:84267) has functional parent sec-butylamine (CHEBI:74526) |
| IUPAC Name |
|---|
| butan-2-amine |
| Synonyms | Source |
|---|---|
| 1-methylpropanamine | ChemIDplus |
| 1-methylpropylamine | ChemIDplus |
| 2-AB | ChemIDplus |
| 2-aminobutane | ChemIDplus |
| 2-butanamine | ChemIDplus |
| 2-butylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 6 | PPDB |
| C18706 | KEGG COMPOUND |
| CN101648874 | Patent |
| CN101648875 | Patent |
| CN1775736 | Patent |
| CPD-3627 | MetaCyc |
| HMDB0032179 | HMDB |
| Sec-Butylamine | Wikipedia |
| US2636902 | Patent |
| US2689868 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1361345 | Reaxys |
| CAS:13952-84-6 | NIST Chemistry WebBook |
| CAS:13952-84-6 | ChemIDplus |
| CAS:13952-84-6 | KEGG COMPOUND |
| Citations |
|---|