EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H43N3O11S |
| Net Charge | 0 |
| Average Mass | 761.850 |
| Monoisotopic Mass | 761.26183 |
| SMILES | [H][C@@]12Cc3cc(C)c(OC)c(O)c3[C@@]([H])(N1C)[C@]1([H])[C@@H]3SC[C@]4(NCCc5cc(O)c(OC)cc54)C(=O)OC[C@@H](c4c5c(c(C)c(OC(C)=O)c43)OCO5)N1[C@H]2O |
| InChI | InChI=1S/C39H43N3O11S/c1-16-9-20-10-22-37(46)42-23-13-50-38(47)39(21-12-25(48-5)24(44)11-19(21)7-8-40-39)14-54-36(30(42)29(41(22)4)26(20)31(45)32(16)49-6)28-27(23)35-34(51-15-52-35)17(2)33(28)53-18(3)43/h9,11-12,22-23,29-30,36-37,40,44-46H,7-8,10,13-15H2,1-6H3/t22-,23-,29+,30+,36+,37-,39+/m0/s1 |
| InChIKey | PKVRCIRHQMSYJX-AIFWHQITSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecteinascidia turbinata (ncbitaxon:284476) | - | PubMed (24941346) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trabectedin (CHEBI:84050) has role alkylating agent (CHEBI:22333) |
| trabectedin (CHEBI:84050) has role angiogenesis modulating agent (CHEBI:50926) |
| trabectedin (CHEBI:84050) has role anti-inflammatory agent (CHEBI:67079) |
| trabectedin (CHEBI:84050) has role antineoplastic agent (CHEBI:35610) |
| trabectedin (CHEBI:84050) has role marine metabolite (CHEBI:76507) |
| trabectedin (CHEBI:84050) is a acetate ester (CHEBI:47622) |
| trabectedin (CHEBI:84050) is a azaspiro compound (CHEBI:35624) |
| trabectedin (CHEBI:84050) is a bridged compound (CHEBI:35990) |
| trabectedin (CHEBI:84050) is a hemiaminal (CHEBI:73080) |
| trabectedin (CHEBI:84050) is a isoquinoline alkaloid (CHEBI:24921) |
| trabectedin (CHEBI:84050) is a lactone (CHEBI:25000) |
| trabectedin (CHEBI:84050) is a organic heteropolycyclic compound (CHEBI:38166) |
| trabectedin (CHEBI:84050) is a organic sulfide (CHEBI:16385) |
| trabectedin (CHEBI:84050) is a oxaspiro compound (CHEBI:37948) |
| trabectedin (CHEBI:84050) is a polyphenol (CHEBI:26195) |
| trabectedin (CHEBI:84050) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (6R,6aR,7R,13S,14S,16R,20R)-6',8,14-trihydroxy-7',9-dimethoxy-4,10,23-trimethyl-19-oxo-3',4',6,7,12,13,14,16-octahydro-2'H,6aH-spiro[7,13-epimino-6,16-(epithiopropanooxymethano)[1,3]dioxolo[7,8]isoquinolino[3,2-b][3]benzazocine-20,1'-isoquinolin]-5-yl acetate |
| INN | Source |
|---|---|
| trabectedin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Ect 743 | ChemIDplus |
| Ecteinascidin | HMDB |
| Ecteinascidin 743 | DrugBank |
| ET-743 | HMDB |
| ET743 | HMDB |
| Brand Name | Source |
|---|---|
| Yondelis | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4633 | DrugCentral |
| C16875 | KEGG COMPOUND |
| D06199 | KEGG DRUG |
| DB05109 | DrugBank |
| HMDB0015609 | HMDB |
| Trabectedin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7617615 | Reaxys |
| CAS:114899-77-3 | KEGG COMPOUND |
| CAS:114899-77-3 | ChemIDplus |
| Citations |
|---|