EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H56O11 |
| Net Charge | 0 |
| Average Mass | 676.844 |
| Monoisotopic Mass | 676.38226 |
| SMILES | CO[C@H]1/C=C/C=C(\C)C[C@H](C)[C@H](O)[C@H](C)/C=C(C)/C=C(\C)C(=O)O[C@@H]1[C@@H](C)[C@@H](O)[C@H](C)[C@@]1(O)C[C@@H](OC(=O)/C=C/C(=O)O)[C@@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C37H56O11/c1-20-12-11-13-29(45-10)35(47-36(43)24(5)18-21(2)17-23(4)33(41)22(3)16-20)26(7)34(42)27(8)37(44)19-30(25(6)28(9)48-37)46-32(40)15-14-31(38)39/h11-15,17-18,22-23,25-30,33-35,41-42,44H,16,19H2,1-10H3,(H,38,39)/b13-11+,15-14+,20-12+,21-17+,24-18+/t22-,23+,25-,26-,27-,28+,29-,30+,33-,34+,35+,37+/m0/s1 |
| InChIKey | GEZBIZMDLMTFDB-KJKHOEIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hygrolidin (CHEBI:83959) has role antimicrobial agent (CHEBI:33281) |
| hygrolidin (CHEBI:83959) has role antineoplastic agent (CHEBI:35610) |
| hygrolidin (CHEBI:83959) has role bacterial metabolite (CHEBI:76969) |
| hygrolidin (CHEBI:83959) is a cyclic hemiketal (CHEBI:59780) |
| hygrolidin (CHEBI:83959) is a enoate ester (CHEBI:51702) |
| hygrolidin (CHEBI:83959) is a ether (CHEBI:25698) |
| hygrolidin (CHEBI:83959) is a macrolide (CHEBI:25106) |
| hygrolidin (CHEBI:83959) is a oxanes (CHEBI:46942) |
| hygrolidin (CHEBI:83959) is a secondary alcohol (CHEBI:35681) |
| hygrolidin (CHEBI:83959) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (5R)-3-O-[(2E)-3-carboxyprop-2-enoyl]-2,4-dideoxy-1-C-{(2S,3R,4S)-3-hydroxy-4-[(2R,3S,4R,6R,9S,10S,11R,12R,14R)-10-hydroxy-3-methoxy-7,9,11,13,15-pentamethyl-16-oxooxacyclohexadeca-4,6,12,14-tetraen-2-yl]pentan-2-yl}-4,5-dimethyl-β-L-erythro-pentopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4629518 | Reaxys |
| Citations |
|---|