EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23Cl2N3O4S |
| Net Charge | 0 |
| Average Mass | 508.427 |
| Monoisotopic Mass | 507.07863 |
| SMILES | CCOC(=O)Nc1ccc(SC[C@H]2CO[C@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C23H23Cl2N3O4S/c1-2-30-22(29)27-17-4-6-19(7-5-17)33-13-18-12-31-23(32-18,14-28-10-9-26-15-28)20-8-3-16(24)11-21(20)25/h3-11,15,18H,2,12-14H2,1H3,(H,27,29)/t18-,23+/m1/s1 |
| InChIKey | OGPIBXIQNMQSPY-JPYJTQIMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,R)-tubulozole (CHEBI:83932) is a ethyl [4-({[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl}sulfanyl)phenyl]carbamate (CHEBI:83931) |
| (R,R)-tubulozole (CHEBI:83932) is enantiomer of (S,S)-tubulozole (CHEBI:83933) |
| Incoming Relation(s) |
| tubulozole (CHEBI:83928) has part (R,R)-tubulozole (CHEBI:83932) |
| (S,S)-tubulozole (CHEBI:83933) is enantiomer of (R,R)-tubulozole (CHEBI:83932) |
| IUPAC Name |
|---|
| ethyl [4-({[(2R,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl}sulfanyl)phenyl]carbamate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25782517 | Reaxys |