EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17Cl2N3O |
| Net Charge | 0 |
| Average Mass | 326.227 |
| Monoisotopic Mass | 325.07487 |
| SMILES | CC(C)(C)[C@@H](O)/C(=C\c1ccc(Cl)cc1Cl)n1cncn1 |
| InChI | InChI=1S/C15H17Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-9,14,21H,1-3H3/b13-6+/t14-/m0/s1 |
| InChIKey | FBOUIAKEJMZPQG-BLXFFLACSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diniconazole-M (CHEBI:83911) has role antifungal agrochemical (CHEBI:86328) |
| diniconazole-M (CHEBI:83911) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| diniconazole-M (CHEBI:83911) is a (1E)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol (CHEBI:83909) |
| diniconazole-M (CHEBI:83911) is a conazole antifungal agent (CHEBI:86323) |
| diniconazole-M (CHEBI:83911) is a conazole fungicide (CHEBI:87067) |
| diniconazole-M (CHEBI:83911) is enantiomer of (S)-diniconazole (CHEBI:83906) |
| Incoming Relation(s) |
| diniconazole (CHEBI:81913) has part diniconazole-M (CHEBI:83911) |
| (S)-diniconazole (CHEBI:83906) is enantiomer of diniconazole-M (CHEBI:83911) |
| IUPAC Name |
|---|
| (1E,3R)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (−)-diniconazole | ChEBI |
| diniconazole (−) | ChemIDplus |
| (E)-(R)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol | Alan Wood's Pesticides |
| (R)-diniconazole | ChEBI |
| R-(−)-diniconazole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2907 | PPDB |
| diniconazole-m | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7381524 | Reaxys |
| CAS:83657-18-5 | ChemIDplus |
| Citations |
|---|