EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17ClN2O |
| Net Charge | 0 |
| Average Mass | 288.778 |
| Monoisotopic Mass | 288.10294 |
| SMILES | CN1OC(c2ccc(Cl)cc2)C[C@]1(C)c1cccnc1 |
| InChI | InChI=1S/C16H17ClN2O/c1-16(13-4-3-9-18-11-13)10-15(20-19(16)2)12-5-7-14(17)8-6-12/h3-9,11,15H,10H2,1-2H3/t15?,16-/m1/s1 |
| InChIKey | DHTJFQWHCVTNRY-OEMAIJDKSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrisoxazole (CHEBI:83823) has part (3R,5R)-pyrisoxazole (CHEBI:83826) |
| pyrisoxazole (CHEBI:83823) has part (3R,5S)-pyrisoxazole (CHEBI:83827) |
| pyrisoxazole (CHEBI:83823) has role antifungal agrochemical (CHEBI:86328) |
| pyrisoxazole (CHEBI:83823) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| pyrisoxazole (CHEBI:83823) is a diastereoisomeric mixture (CHEBI:60915) |
| IUPAC Name |
|---|
| 3-[(3R)-5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidin-3-yl]pyridine |
| Synonym | Source |
|---|---|
| Dingjunezuo | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2616 | PPDB |
| pyrisoxazole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28750612 | Reaxys |
| CAS:847749-37-5 | ChemIDplus |
| Citations |
|---|