EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38N4O3S2 |
| Net Charge | 0 |
| Average Mass | 470.705 |
| Monoisotopic Mass | 470.23853 |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC[C@@H](NC[C@@H](N)CS)C(C)C)C(=O)O |
| InChI | InChI=1S/C22H38N4O3S2/c1-15(2)20(24-12-17(23)14-30)13-25-19(11-16-7-5-4-6-8-16)21(27)26-18(22(28)29)9-10-31-3/h4-8,15,17-20,24-25,30H,9-14,23H2,1-3H3,(H,26,27)(H,28,29)/t17-,18+,19+,20-/m1/s1 |
| InChIKey | QISLMXIYRQCLIR-FUMNGEBKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | peptidomimetic A small protein-like chain designed to mimic a peptide. EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| B 581 (CHEBI:83620) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| B 581 (CHEBI:83620) has role peptidomimetic (CHEBI:63175) |
| B 581 (CHEBI:83620) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-[(2S)-2-{[(2R)-2-amino-3-sulfanylpropyl]amino}-3-methylbutyl]-L-phenylalanyl-L-methionine |
| Manual Xrefs | Databases |
|---|---|
| LSM-2081 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8293687 | Reaxys |
| CAS:149759-96-6 | ChemIDplus |
| Citations |
|---|