EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H2F16O2 |
| Net Charge | 0 |
| Average Mass | 458.092 |
| Monoisotopic Mass | 457.97993 |
| SMILES | [H]C(C(=O)O)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H2F16O2/c11-2(1-3(27)28)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)26/h1H,(H,27,28) |
| InChIKey | WHZXTVOEGZRRJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8:2 fluorotelomer unsaturated carboxylic acid (CHEBI:83495) has role persistent organic pollutant (CHEBI:77853) |
| 8:2 fluorotelomer unsaturated carboxylic acid (CHEBI:83495) has role xenobiotic (CHEBI:35703) |
| 8:2 fluorotelomer unsaturated carboxylic acid (CHEBI:83495) is a fluorotelomer (CHEBI:83814) |
| 8:2 fluorotelomer unsaturated carboxylic acid (CHEBI:83495) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodec-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2192188 | Reaxys |