EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H2Cl3NO |
| Net Charge | 0 |
| Average Mass | 198.436 |
| Monoisotopic Mass | 196.92020 |
| SMILES | O=c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C5H2Cl3NO/c6-2-1-3(7)5(10)9-4(2)8/h1H,(H,9,10) |
| InChIKey | WCYYAQFQZQEUEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5,6-trichloropyridine-2-one (CHEBI:83490) has role marine xenobiotic metabolite (CHEBI:83399) |
| 3,5,6-trichloropyridine-2-one (CHEBI:83490) is a chloropyridine (CHEBI:39173) |
| 3,5,6-trichloropyridine-2-one (CHEBI:83490) is a pyridone (CHEBI:38183) |
| 3,5,6-trichloropyridine-2-one (CHEBI:83490) is tautomer of 3,5,6-trichloro-2-pyridinol (CHEBI:143794) |
| Incoming Relation(s) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) is tautomer of 3,5,6-trichloropyridine-2-one (CHEBI:83490) |
| IUPAC Name |
|---|
| 3,5,6-trichloropyridin-2(1H)-one |
| Synonym | Source |
|---|---|
| 3,5,6-trichloro-2-pyridin-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1448677 | Reaxys |
| CAS:6515-38-4 | ChemIDplus |