EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H2Cl3NO |
| Net Charge | 0 |
| Average Mass | 198.436 |
| Monoisotopic Mass | 196.92020 |
| SMILES | Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C5H2Cl3NO/c6-2-1-3(7)5(10)9-4(2)8/h1H,(H,9,10) |
| InChIKey | WCYYAQFQZQEUEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) has role human urinary metabolite (CHEBI:84087) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) has role human xenobiotic metabolite (CHEBI:76967) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) is a chloropyridine (CHEBI:39173) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) is a hydroxypyridine (CHEBI:24745) |
| 3,5,6-trichloro-2-pyridinol (CHEBI:143794) is tautomer of 3,5,6-trichloropyridine-2-one (CHEBI:83490) |
| Incoming Relation(s) |
| 3,5,6-trichloropyridine-2-one (CHEBI:83490) is tautomer of 3,5,6-trichloro-2-pyridinol (CHEBI:143794) |
| IUPAC Name |
|---|
| 3,5,6-trichloropyridin-2-ol |
| Synonyms | Source |
|---|---|
| 2,3,5-trichloro-6-pyridinol | ChEBI |
| 2,3,5-trichloropyridine-6-ol | ChEBI |
| 2-hydroxy-3,5,6-trichloropyridine | NIST Chemistry WebBook |
| 3,5,6-trichloro-2-hydroxypyridine | NIST Chemistry WebBook |
| 3,5,6-trichloropyridine-2-ol | HMDB |
| 3,5,6-tris(chloranyl)pyridin-2-ol | PDBeChem |
| UniProt Name | Source |
|---|---|
| 3,5,6-trichloropyridin-2-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6GNP | PDB |
| F4Z | PDBeChem |
| HMDB0039853 | HMDB |
| Citations |
|---|