EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N4O2 |
| Net Charge | 0 |
| Average Mass | 184.199 |
| Monoisotopic Mass | 184.09603 |
| SMILES | CC(C)(C)c1nnc(=O)n(N)c1=O |
| InChI | InChI=1S/C7H12N4O2/c1-7(2,3)4-5(12)11(8)6(13)10-9-4/h8H2,1-3H3,(H,10,13) |
| InChIKey | AHBXXEZLRFCZSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metribuzin-diketo (CHEBI:83448) has role marine xenobiotic metabolite (CHEBI:83399) |
| metribuzin-diketo (CHEBI:83448) is a 1,2,4-triazines (CHEBI:39410) |
| metribuzin-diketo (CHEBI:83448) is a diketone (CHEBI:46640) |
| IUPAC Name |
|---|
| 4-amino-6-tert-butyl-1,2,4-triazine-3,5(2H,4H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4441906 | Reaxys |
| CAS:56507-37-0 | ChemIDplus |
| Citations |
|---|